C34H52 — CID 20671415
1-(2,4,4,9,9,11,11-heptamethylhexadeca-5,7,12,14-tetrayn-2-yl)-2-(2,4,4-trimethylpentan-2-yl)cyclopropane (PubChem CID 20671415) has the molecular formula C34H52 and a molecular weight of 460.79 g/mol. Its IUPAC name is 1-(2,4,4,9,9,11,11-heptamethylhexadeca-5,7,12,14-tetrayn-2-yl)-2-(2,4,4-trimethylpentan-2-yl)cyclopropane.
| Compound Name | 1-(2,4,4,9,9,11,11-heptamethylhexadeca-5,7,12,14-tetrayn-2-yl)-2-(2,4,4-trimethylpentan-2-yl)cyclopropane |
|---|---|
| PubChem CID | 20671415 |
| Molecular Formula | C34H52 |
| Molecular Weight | 460.79 g/mol |
| Exact Mass | 460.41 |
| IUPAC Name | 1-(2,4,4,9,9,11,11-heptamethylhexadeca-5,7,12,14-tetrayn-2-yl)-2-(2,4,4-trimethylpentan-2-yl)cyclopropane |
| SMILES | CC#CC#CC(C)(C)CC(C)(C)C#CC#CC(C)(C)CC(C)(C)C1CC1C(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C34H52/c1-15-16-17-20-30(5,6)25-31(7,8)21-18-19-22-32(9,10)26-34(13,14)28-23-27(28)33(11,12)24-29(2,3)4/h27-28H,23-26H2,1-14H3 |
| InChIKey | BKNAHANSJCSSAP-UHFFFAOYSA-N |
| XLogP | 9.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.79 |
| LogP ≤ 5 | 9.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|