C30H52 — CID 20671413
1-(2,4,4,7,7,9,9-heptamethyldodeca-5,10-diyn-2-yl)-2-(2,4,4-trimethylpentan-2-yl)cyclopropane (PubChem CID 20671413) has the molecular formula C30H52 and a molecular weight of 412.75 g/mol. Its IUPAC name is 1-(2,4,4,7,7,9,9-heptamethyldodeca-5,10-diyn-2-yl)-2-(2,4,4-trimethylpentan-2-yl)cyclopropane.
| Compound Name | 1-(2,4,4,7,7,9,9-heptamethyldodeca-5,10-diyn-2-yl)-2-(2,4,4-trimethylpentan-2-yl)cyclopropane |
|---|---|
| PubChem CID | 20671413 |
| Molecular Formula | C30H52 |
| Molecular Weight | 412.75 g/mol |
| Exact Mass | 412.41 |
| IUPAC Name | 1-(2,4,4,7,7,9,9-heptamethyldodeca-5,10-diyn-2-yl)-2-(2,4,4-trimethylpentan-2-yl)cyclopropane |
| SMILES | CC#CC(C)(C)CC(C)(C)C#CC(C)(C)CC(C)(C)C1CC1C(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C30H52/c1-15-16-26(5,6)21-27(7,8)17-18-28(9,10)22-30(13,14)24-19-23(24)29(11,12)20-25(2,3)4/h23-24H,19-22H2,1-14H3 |
| InChIKey | FVXJUMBGUIOZMR-UHFFFAOYSA-N |
| XLogP | 9.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.75 |
| LogP ≤ 5 | 9.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|