C34H44FN3O2 — CID 20672483
2-[3-[[4-[3-(2-cyanophenyl)propyl]piperidin-1-yl]methyl]-4-(3-fluorophenyl)pyrrolidin-1-yl]-2-cyclohexylacetic acid (PubChem CID 20672483) has the molecular formula C34H44FN3O2 and a molecular weight of 545.74 g/mol. Its IUPAC name is 2-[3-[[4-[3-(2-cyanophenyl)propyl]piperidin-1-yl]methyl]-4-(3-fluorophenyl)pyrrolidin-1-yl]-2-cyclohexylacetic acid.
| Compound Name | 2-[3-[[4-[3-(2-cyanophenyl)propyl]piperidin-1-yl]methyl]-4-(3-fluorophenyl)pyrrolidin-1-yl]-2-cyclohexylacetic acid |
|---|---|
| PubChem CID | 20672483 |
| Molecular Formula | C34H44FN3O2 |
| Molecular Weight | 545.74 g/mol |
| Exact Mass | 545.34 |
| IUPAC Name | 2-[3-[[4-[3-(2-cyanophenyl)propyl]piperidin-1-yl]methyl]-4-(3-fluorophenyl)pyrrolidin-1-yl]-2-cyclohexylacetic acid |
| SMILES | N#Cc1ccccc1CCCC1CCN(CC2CN(C(C(=O)O)C3CCCCC3)CC2c2cccc(F)c2)CC1 |
| InChI | InChI=1S/C34H44FN3O2/c35-31-15-7-14-28(20-31)32-24-38(33(34(39)40)27-10-2-1-3-11-27)23-30(32)22-37-18-16-25(17-19-37)8-6-13-26-9-4-5-12-29(26)21-36/h4-5,7,9,12,14-15,20,25,27,30,32-33H,1-3,6,8,10-11,13,16-19,22-24H2,(H,39,40) |
| InChIKey | MSPARUSPZXJFLY-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 67.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.74 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |