C34H47FN2O3 — CID 20672565
2-cyclohexyl-2-[3-(3-fluorophenyl)-4-[[4-[3-(2-methoxyphenyl)propyl]piperidin-1-yl]methyl]pyrrolidin-1-yl]acetic acid (PubChem CID 20672565) has the molecular formula C34H47FN2O3 and a molecular weight of 550.76 g/mol. Its IUPAC name is 2-cyclohexyl-2-[3-(3-fluorophenyl)-4-[[4-[3-(2-methoxyphenyl)propyl]piperidin-1-yl]methyl]pyrrolidin-1-yl]acetic acid.
| Compound Name | 2-cyclohexyl-2-[3-(3-fluorophenyl)-4-[[4-[3-(2-methoxyphenyl)propyl]piperidin-1-yl]methyl]pyrrolidin-1-yl]acetic acid |
|---|---|
| PubChem CID | 20672565 |
| Molecular Formula | C34H47FN2O3 |
| Molecular Weight | 550.76 g/mol |
| Exact Mass | 550.36 |
| IUPAC Name | 2-cyclohexyl-2-[3-(3-fluorophenyl)-4-[[4-[3-(2-methoxyphenyl)propyl]piperidin-1-yl]methyl]pyrrolidin-1-yl]acetic acid |
| SMILES | COc1ccccc1CCCC1CCN(CC2CN(C(C(=O)O)C3CCCCC3)CC2c2cccc(F)c2)CC1 |
| InChI | InChI=1S/C34H47FN2O3/c1-40-32-16-6-5-10-26(32)13-7-9-25-17-19-36(20-18-25)22-29-23-37(24-31(29)28-14-8-15-30(35)21-28)33(34(38)39)27-11-3-2-4-12-27/h5-6,8,10,14-16,21,25,27,29,31,33H,2-4,7,9,11-13,17-20,22-24H2,1H3,(H,38,39) |
| InChIKey | JCXCKOSEBBAIHS-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.76 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |