C25H30N2O2 — CID 20673027
4-(2,6-dimethylphenyl)-2-[2-[4-(2,6-dimethylphenyl)-4,5-dihydro-1,3-oxazol-2-yl]propan-2-yl]-4,5-dihydro-1,3-oxazole (PubChem CID 20673027) has the molecular formula C25H30N2O2 and a molecular weight of 390.53 g/mol. Its IUPAC name is 4-(2,6-dimethylphenyl)-2-[2-[4-(2,6-dimethylphenyl)-4,5-dihydro-1,3-oxazol-2-yl]propan-2-yl]-4,5-dihydro-1,3-oxazole.
| Compound Name | 4-(2,6-dimethylphenyl)-2-[2-[4-(2,6-dimethylphenyl)-4,5-dihydro-1,3-oxazol-2-yl]propan-2-yl]-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 20673027 |
| Molecular Formula | C25H30N2O2 |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.23 |
| IUPAC Name | 4-(2,6-dimethylphenyl)-2-[2-[4-(2,6-dimethylphenyl)-4,5-dihydro-1,3-oxazol-2-yl]propan-2-yl]-4,5-dihydro-1,3-oxazole |
| SMILES | Cc1cccc(C)c1C1COC(C(C)(C)C2=NC(c3c(C)cccc3C)CO2)=N1 |
| InChI | InChI=1S/C25H30N2O2/c1-15-9-7-10-16(2)21(15)19-13-28-23(26-19)25(5,6)24-27-20(14-29-24)22-17(3)11-8-12-18(22)4/h7-12,19-20H,13-14H2,1-6H3 |
| InChIKey | LWFDGSDURMXEPB-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |