About N-(4,4-diethoxybutyl)-2-methyl-2-(prop-2-enoylamino)propanamide
N-(4,4-diethoxybutyl)-2-methyl-2-(prop-2-enoylamino)propanamide (PubChem CID 20673048) has the molecular formula C15H28N2O4
and a molecular weight of 300.40 g/mol. Its IUPAC name is N-(4,4-diethoxybutyl)-2-methyl-2-(prop-2-enoylamino)propanamide.
Molecular Properties
| Compound Name | N-(4,4-diethoxybutyl)-2-methyl-2-(prop-2-enoylamino)propanamide |
| PubChem CID | 20673048 |
| Molecular Formula | C15H28N2O4 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.20 |
| IUPAC Name | N-(4,4-diethoxybutyl)-2-methyl-2-(prop-2-enoylamino)propanamide |
| SMILES | C=CC(=O)NC(C)(C)C(=O)NCCCC(OCC)OCC |
| InChI | InChI=1S/C15H28N2O4/c1-6-12(18)17-15(4,5)14(19)16-11-9-10-13(20-7-2)21-8-3/h6,13H,1,7-11H2,2-5H3,(H,16,19)(H,17,18) |
| InChIKey | LATACNKVOHKBKZ-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N-(4,4-diethoxybutyl)-2-methyl-2-(prop-2-enoylamino)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4,4-diethoxybutyl)-2-methyl-2-(prop-2-enoylamino)propanamide?
The IUPAC name of N-(4,4-diethoxybutyl)-2-methyl-2-(prop-2-enoylamino)propanamide (CID 20673048) is N-(4,4-diethoxybutyl)-2-methyl-2-(prop-2-enoylamino)propanamide.
What is the SMILES notation for N-(4,4-diethoxybutyl)-2-methyl-2-(prop-2-enoylamino)propanamide?
The canonical SMILES for N-(4,4-diethoxybutyl)-2-methyl-2-(prop-2-enoylamino)propanamide is C=CC(=O)NC(C)(C)C(=O)NCCCC(OCC)OCC.
What is the InChIKey of N-(4,4-diethoxybutyl)-2-methyl-2-(prop-2-enoylamino)propanamide?
The InChIKey is LATACNKVOHKBKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H28N2O4/c1-6-12(18)17-15(4,5)14(19)16-11-9-10-13(20-7-2)21-8-3/h6,13H,1,7-11H2,2-5H3,(H,16,19)(H,17,18).
What are the key properties of N-(4,4-diethoxybutyl)-2-methyl-2-(prop-2-enoylamino)propanamide?
N-(4,4-diethoxybutyl)-2-methyl-2-(prop-2-enoylamino)propanamide has a molecular weight of 300.40 g/mol, XLogP of 1.36, 11 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4,4-diethoxybutyl)-2-methyl-2-(prop-2-enoylamino)propanamide is sourced from PubChem (CID 20673048), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).