C15H28N2O4 — CID 21182210
N-(2,2-diethoxybutyl)-2-methyl-2-(prop-2-enoylamino)propanamide (PubChem CID 21182210) has the molecular formula C15H28N2O4 and a molecular weight of 300.40 g/mol. Its IUPAC name is N-(2,2-diethoxybutyl)-2-methyl-2-(prop-2-enoylamino)propanamide.
| Compound Name | N-(2,2-diethoxybutyl)-2-methyl-2-(prop-2-enoylamino)propanamide |
|---|---|
| PubChem CID | 21182210 |
| Molecular Formula | C15H28N2O4 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.20 |
| IUPAC Name | N-(2,2-diethoxybutyl)-2-methyl-2-(prop-2-enoylamino)propanamide |
| SMILES | C=CC(=O)NC(C)(C)C(=O)NCC(CC)(OCC)OCC |
| InChI | InChI=1S/C15H28N2O4/c1-7-12(18)17-14(5,6)13(19)16-11-15(8-2,20-9-3)21-10-4/h7H,1,8-11H2,2-6H3,(H,16,19)(H,17,18) |
| InChIKey | GMWFDRCWLCTKNA-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|