About 3-methyl-4,5,6,7,8,9-hexahydro-2H-cycloocta[b]pyrrole
3-methyl-4,5,6,7,8,9-hexahydro-2H-cycloocta[b]pyrrole (PubChem CID 20674236) has the molecular formula C11H17N
and a molecular weight of 163.26 g/mol. Its IUPAC name is 3-methyl-4,5,6,7,8,9-hexahydro-2H-cycloocta[b]pyrrole.
Analyze 3-methyl-4,5,6,7,8,9-hexahydro-2H-cycloocta[b]pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-4,5,6,7,8,9-hexahydro-2H-cycloocta[b]pyrrole?
The IUPAC name of 3-methyl-4,5,6,7,8,9-hexahydro-2H-cycloocta[b]pyrrole (CID 20674236) is 3-methyl-4,5,6,7,8,9-hexahydro-2H-cycloocta[b]pyrrole.
What is the SMILES notation for 3-methyl-4,5,6,7,8,9-hexahydro-2H-cycloocta[b]pyrrole?
The canonical SMILES for 3-methyl-4,5,6,7,8,9-hexahydro-2H-cycloocta[b]pyrrole is CC1=C2CCCCCCC2=NC1.
What is the InChIKey of 3-methyl-4,5,6,7,8,9-hexahydro-2H-cycloocta[b]pyrrole?
The InChIKey is XVAKKAZRWHLPQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N/c1-9-8-12-11-7-5-3-2-4-6-10(9)11/h2-8H2,1H3.
What are the key properties of 3-methyl-4,5,6,7,8,9-hexahydro-2H-cycloocta[b]pyrrole?
3-methyl-4,5,6,7,8,9-hexahydro-2H-cycloocta[b]pyrrole has a molecular weight of 163.26 g/mol, XLogP of 3.11, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-4,5,6,7,8,9-hexahydro-2H-cycloocta[b]pyrrole is sourced from PubChem (CID 20674236), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).