C13H25N — CID 90760061
ethane;3-methyl-4,5,6,7-tetrahydro-1H-cyclopenta[c]pyridine (PubChem CID 90760061) has the molecular formula C13H25N and a molecular weight of 195.35 g/mol. Its IUPAC name is ethane;3-methyl-4,5,6,7-tetrahydro-1H-cyclopenta[c]pyridine.
| Compound Name | ethane;3-methyl-4,5,6,7-tetrahydro-1H-cyclopenta[c]pyridine |
|---|---|
| PubChem CID | 90760061 |
| Molecular Formula | C13H25N |
| Molecular Weight | 195.35 g/mol |
| Exact Mass | 195.20 |
| IUPAC Name | ethane;3-methyl-4,5,6,7-tetrahydro-1H-cyclopenta[c]pyridine |
| SMILES | CC.CC.CC1=NCC2=C(CCC2)C1 |
| InChI | InChI=1S/C9H13N.2C2H6/c1-7-5-8-3-2-4-9(8)6-10-7;2*1-2/h2-6H2,1H3;2*1-2H3 |
| InChIKey | ADJOVBLXNYQCSM-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.35 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|