About 3,5,6-trimethyl-4,7-dihydro-1H-cyclopenta[c]pyridine
3,5,6-trimethyl-4,7-dihydro-1H-cyclopenta[c]pyridine (PubChem CID 20647161) has the molecular formula C11H15N
and a molecular weight of 161.25 g/mol. Its IUPAC name is 3,5,6-trimethyl-4,7-dihydro-1H-cyclopenta[c]pyridine.
Analyze 3,5,6-trimethyl-4,7-dihydro-1H-cyclopenta[c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5,6-trimethyl-4,7-dihydro-1H-cyclopenta[c]pyridine?
The IUPAC name of 3,5,6-trimethyl-4,7-dihydro-1H-cyclopenta[c]pyridine (CID 20647161) is 3,5,6-trimethyl-4,7-dihydro-1H-cyclopenta[c]pyridine.
What is the SMILES notation for 3,5,6-trimethyl-4,7-dihydro-1H-cyclopenta[c]pyridine?
The canonical SMILES for 3,5,6-trimethyl-4,7-dihydro-1H-cyclopenta[c]pyridine is CC1=NCC2=C(C1)C(C)=C(C)C2.
What is the InChIKey of 3,5,6-trimethyl-4,7-dihydro-1H-cyclopenta[c]pyridine?
The InChIKey is WNGZOILDTFZXFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N/c1-7-4-10-6-12-8(2)5-11(10)9(7)3/h4-6H2,1-3H3.
What are the key properties of 3,5,6-trimethyl-4,7-dihydro-1H-cyclopenta[c]pyridine?
3,5,6-trimethyl-4,7-dihydro-1H-cyclopenta[c]pyridine has a molecular weight of 161.25 g/mol, XLogP of 2.89, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5,6-trimethyl-4,7-dihydro-1H-cyclopenta[c]pyridine is sourced from PubChem (CID 20647161), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).