About ethane;3-methyl-5,6-dihydro-1H-isoindole
ethane;3-methyl-5,6-dihydro-1H-isoindole (PubChem CID 143453366) has the molecular formula C11H17N
and a molecular weight of 163.26 g/mol. Its IUPAC name is ethane;3-methyl-5,6-dihydro-1H-isoindole.
Molecular Properties
| Compound Name | ethane;3-methyl-5,6-dihydro-1H-isoindole |
| PubChem CID | 143453366 |
| Molecular Formula | C11H17N |
| Molecular Weight | 163.26 g/mol |
| Exact Mass | 163.14 |
| IUPAC Name | ethane;3-methyl-5,6-dihydro-1H-isoindole |
| SMILES | CC.CC1=NCC2=CCCC=C21 |
| InChI | InChI=1S/C9H11N.C2H6/c1-7-9-5-3-2-4-8(9)6-10-7;1-2/h4-5H,2-3,6H2,1H3;1-2H3 |
| InChIKey | YGWRTJVKIDPNFO-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.26 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;3-methyl-5,6-dihydro-1H-isoindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-methyl-5,6-dihydro-1H-isoindole?
The IUPAC name of ethane;3-methyl-5,6-dihydro-1H-isoindole (CID 143453366) is ethane;3-methyl-5,6-dihydro-1H-isoindole.
What is the SMILES notation for ethane;3-methyl-5,6-dihydro-1H-isoindole?
The canonical SMILES for ethane;3-methyl-5,6-dihydro-1H-isoindole is CC.CC1=NCC2=CCCC=C21.
What is the InChIKey of ethane;3-methyl-5,6-dihydro-1H-isoindole?
The InChIKey is YGWRTJVKIDPNFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N.C2H6/c1-7-9-5-3-2-4-8(9)6-10-7;1-2/h4-5H,2-3,6H2,1H3;1-2H3.
What are the key properties of ethane;3-methyl-5,6-dihydro-1H-isoindole?
ethane;3-methyl-5,6-dihydro-1H-isoindole has a molecular weight of 163.26 g/mol, XLogP of 3.13, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-methyl-5,6-dihydro-1H-isoindole is sourced from PubChem (CID 143453366), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).