C17H17F2NO3 — CID 2067465
N-[2-(difluoromethoxy)phenyl]-3-propoxybenzamide (PubChem CID 2067465) has the molecular formula C17H17F2NO3 and a molecular weight of 321.32 g/mol. Its IUPAC name is N-[2-(difluoromethoxy)phenyl]-3-propoxybenzamide.
| Compound Name | N-[2-(difluoromethoxy)phenyl]-3-propoxybenzamide |
|---|---|
| PubChem CID | 2067465 |
| Molecular Formula | C17H17F2NO3 |
| Molecular Weight | 321.32 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | N-[2-(difluoromethoxy)phenyl]-3-propoxybenzamide |
| SMILES | CCCOc1cccc(C(=O)Nc2ccccc2OC(F)F)c1 |
| InChI | InChI=1S/C17H17F2NO3/c1-2-10-22-13-7-5-6-12(11-13)16(21)20-14-8-3-4-9-15(14)23-17(18)19/h3-9,11,17H,2,10H2,1H3,(H,20,21) |
| InChIKey | JMCKPMJVAWYGHL-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.32 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |