C15H25NO — CID 20675918
(NE)-N-[(1,1,2,3,3-pentamethyl-4,5,6,7-tetrahydro-2H-inden-4-yl)methylidene]hydroxylamine (PubChem CID 20675918) has the molecular formula C15H25NO and a molecular weight of 235.37 g/mol. Its IUPAC name is (NE)-N-[(1,1,2,3,3-pentamethyl-4,5,6,7-tetrahydro-2H-inden-4-yl)methylidene]hydroxylamine.
| Compound Name | (NE)-N-[(1,1,2,3,3-pentamethyl-4,5,6,7-tetrahydro-2H-inden-4-yl)methylidene]hydroxylamine |
|---|---|
| PubChem CID | 20675918 |
| Molecular Formula | C15H25NO |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.19 |
| IUPAC Name | (NE)-N-[(1,1,2,3,3-pentamethyl-4,5,6,7-tetrahydro-2H-inden-4-yl)methylidene]hydroxylamine |
| SMILES | CC1C(C)(C)C2=C(C(/C=N/O)CCC2)C1(C)C |
| InChI | InChI=1S/C15H25NO/c1-10-14(2,3)12-8-6-7-11(9-16-17)13(12)15(10,4)5/h9-11,17H,6-8H2,1-5H3/b16-9+ |
| InChIKey | OYXNLAPYQCXETR-CXUHLZMHSA-N |
| XLogP | 4.25 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|