C10H21N3O+2 — CID 20676163
N-methyl-2-(4-methyl-1,4-diazoniabicyclo[2.2.2]octan-1-yl)acetamide (PubChem CID 20676163) has the molecular formula C10H21N3O+2 and a molecular weight of 199.30 g/mol. Its IUPAC name is N-methyl-2-(4-methyl-1,4-diazoniabicyclo[2.2.2]octan-1-yl)acetamide.
| Compound Name | N-methyl-2-(4-methyl-1,4-diazoniabicyclo[2.2.2]octan-1-yl)acetamide |
|---|---|
| PubChem CID | 20676163 |
| Molecular Formula | C10H21N3O+2 |
| Molecular Weight | 199.30 g/mol |
| Exact Mass | 199.17 |
| IUPAC Name | N-methyl-2-(4-methyl-1,4-diazoniabicyclo[2.2.2]octan-1-yl)acetamide |
| SMILES | CNC(=O)C[N+]12CC[N+](C)(CC1)CC2 |
| InChI | InChI=1S/C10H20N3O/c1-11-10(14)9-13-6-3-12(2,4-7-13)5-8-13/h3-9H2,1-2H3/q+1/p+1 |
| InChIKey | WWBYOBLLRYLNIL-UHFFFAOYSA-O |
| XLogP | -0.98 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.30 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|