C10H17F3N3O+ — CID 8717260
2-(4-aza-1-azoniabicyclo[2.2.2]octan-1-yl)-N-(2,2,2-trifluoroethyl)acetamide (PubChem CID 8717260) has the molecular formula C10H17F3N3O+ and a molecular weight of 252.26 g/mol. Its IUPAC name is 2-(4-aza-1-azoniabicyclo[2.2.2]octan-1-yl)-N-(2,2,2-trifluoroethyl)acetamide.
| Compound Name | 2-(4-aza-1-azoniabicyclo[2.2.2]octan-1-yl)-N-(2,2,2-trifluoroethyl)acetamide |
|---|---|
| PubChem CID | 8717260 |
| Molecular Formula | C10H17F3N3O+ |
| Molecular Weight | 252.26 g/mol |
| Exact Mass | 252.13 |
| IUPAC Name | 2-(4-aza-1-azoniabicyclo[2.2.2]octan-1-yl)-N-(2,2,2-trifluoroethyl)acetamide |
| SMILES | O=C(C[N+]12CCN(CC1)CC2)NCC(F)(F)F |
| InChI | InChI=1S/C10H16F3N3O/c11-10(12,13)8-14-9(17)7-16-4-1-15(2-5-16)3-6-16/h1-8H2/p+1 |
| InChIKey | HCIOULQDBCQLTK-UHFFFAOYSA-O |
| XLogP | -0.19 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.26 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|