C12H24NS+ — CID 20676427
2,3-diethyl-8-thia-5-azoniaspiro[4.5]decane (PubChem CID 20676427) has the molecular formula C12H24NS+ and a molecular weight of 214.40 g/mol. Its IUPAC name is 2,3-diethyl-8-thia-5-azoniaspiro[4.5]decane.
| Compound Name | 2,3-diethyl-8-thia-5-azoniaspiro[4.5]decane |
|---|---|
| PubChem CID | 20676427 |
| Molecular Formula | C12H24NS+ |
| Molecular Weight | 214.40 g/mol |
| Exact Mass | 214.16 |
| IUPAC Name | 2,3-diethyl-8-thia-5-azoniaspiro[4.5]decane |
| SMILES | CCC1C[N+]2(CCSCC2)CC1CC |
| InChI | InChI=1S/C12H24NS/c1-3-11-9-13(10-12(11)4-2)5-7-14-8-6-13/h11-12H,3-10H2,1-2H3/q+1 |
| InChIKey | UFGNYQIDKRATIR-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.40 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|