C10H19NS — CID 58516172
2,8-dimethyl-1-thia-8-azaspiro[4.5]decane (PubChem CID 58516172) has the molecular formula C10H19NS and a molecular weight of 185.34 g/mol. Its IUPAC name is 2,8-dimethyl-1-thia-8-azaspiro[4.5]decane.
| Compound Name | 2,8-dimethyl-1-thia-8-azaspiro[4.5]decane |
|---|---|
| PubChem CID | 58516172 |
| Molecular Formula | C10H19NS |
| Molecular Weight | 185.34 g/mol |
| Exact Mass | 185.12 |
| IUPAC Name | 2,8-dimethyl-1-thia-8-azaspiro[4.5]decane |
| SMILES | CC1CCC2(CCN(C)CC2)S1 |
| InChI | InChI=1S/C10H19NS/c1-9-3-4-10(12-9)5-7-11(2)8-6-10/h9H,3-8H2,1-2H3 |
| InChIKey | ONRWNYZEMTUMLS-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.34 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |