C11H21NS — CID 54150037
(3aR,7aS)-5-tert-butyl-3,3a,4,6,7,7a-hexahydro-2H-thieno[3,2-c]pyridine (PubChem CID 54150037) has the molecular formula C11H21NS and a molecular weight of 199.36 g/mol. Its IUPAC name is (3aR,7aS)-5-tert-butyl-3,3a,4,6,7,7a-hexahydro-2H-thieno[3,2-c]pyridine.
| Compound Name | (3aR,7aS)-5-tert-butyl-3,3a,4,6,7,7a-hexahydro-2H-thieno[3,2-c]pyridine |
|---|---|
| PubChem CID | 54150037 |
| Molecular Formula | C11H21NS |
| Molecular Weight | 199.36 g/mol |
| Exact Mass | 199.14 |
| IUPAC Name | (3aR,7aS)-5-tert-butyl-3,3a,4,6,7,7a-hexahydro-2H-thieno[3,2-c]pyridine |
| SMILES | CC(C)(C)N1CC[C@@H]2SCC[C@@H]2C1 |
| InChI | InChI=1S/C11H21NS/c1-11(2,3)12-6-4-10-9(8-12)5-7-13-10/h9-10H,4-8H2,1-3H3/t9-,10+/m1/s1 |
| InChIKey | OHCFDXPIQHKFQK-ZJUUUORDSA-N |
| XLogP | 2.61 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.36 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |