C16H24 — CID 20676890
4-tert-butyl-10-methylundeca-4,5,9-trien-2-yne (PubChem CID 20676890) has the molecular formula C16H24 and a molecular weight of 216.37 g/mol. Its IUPAC name is 4-tert-butyl-10-methylundeca-4,5,9-trien-2-yne.
| Compound Name | 4-tert-butyl-10-methylundeca-4,5,9-trien-2-yne |
|---|---|
| PubChem CID | 20676890 |
| Molecular Formula | C16H24 |
| Molecular Weight | 216.37 g/mol |
| Exact Mass | 216.19 |
| IUPAC Name | 4-tert-butyl-10-methylundeca-4,5,9-trien-2-yne |
| SMILES | CC#CC(=C=CCCC=C(C)C)C(C)(C)C |
| InChI | InChI=1S/C16H24/c1-7-11-15(16(4,5)6)13-10-8-9-12-14(2)3/h10,12H,8-9H2,1-6H3 |
| InChIKey | VXXFJSGZAIAVTH-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.37 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|