C24H40 — CID 10871189
(3E,5E,7Z)-5,8-ditert-butyl-2,2,11,11-tetramethyldodeca-3,5,7-trien-9-yne (PubChem CID 10871189) has the molecular formula C24H40 and a molecular weight of 328.58 g/mol. Its IUPAC name is (3E,5E,7Z)-5,8-ditert-butyl-2,2,11,11-tetramethyldodeca-3,5,7-trien-9-yne.
| Compound Name | (3E,5E,7Z)-5,8-ditert-butyl-2,2,11,11-tetramethyldodeca-3,5,7-trien-9-yne |
|---|---|
| PubChem CID | 10871189 |
| Molecular Formula | C24H40 |
| Molecular Weight | 328.58 g/mol |
| Exact Mass | 328.31 |
| IUPAC Name | (3E,5E,7Z)-5,8-ditert-butyl-2,2,11,11-tetramethyldodeca-3,5,7-trien-9-yne |
| SMILES | CC(C)(C)C#C/C(=C\C=C(/C=C/C(C)(C)C)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C24H40/c1-21(2,3)17-15-19(23(7,8)9)13-14-20(24(10,11)12)16-18-22(4,5)6/h13-15,17H,1-12H3/b17-15+,19-13+,20-14+ |
| InChIKey | JQEYCSATYANKOT-XUHJCMKASA-N |
| XLogP | 7.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.58 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|