C28H42 — CID 46918896
(5E,11E)-3,14-ditert-butyl-2,2,15,15-tetramethylhexadeca-3,5,11,13-tetraen-7,9-diyne (PubChem CID 46918896) has the molecular formula C28H42 and a molecular weight of 378.64 g/mol. Its IUPAC name is (5E,11E)-3,14-ditert-butyl-2,2,15,15-tetramethylhexadeca-3,5,11,13-tetraen-7,9-diyne.
| Compound Name | (5E,11E)-3,14-ditert-butyl-2,2,15,15-tetramethylhexadeca-3,5,11,13-tetraen-7,9-diyne |
|---|---|
| PubChem CID | 46918896 |
| Molecular Formula | C28H42 |
| Molecular Weight | 378.64 g/mol |
| Exact Mass | 378.33 |
| IUPAC Name | (5E,11E)-3,14-ditert-butyl-2,2,15,15-tetramethylhexadeca-3,5,11,13-tetraen-7,9-diyne |
| SMILES | CC(C)(C)C(=C/C=C/C#CC#C/C=C/C=C(C(C)(C)C)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C28H42/c1-25(2,3)23(26(4,5)6)21-19-17-15-13-14-16-18-20-22-24(27(7,8)9)28(10,11)12/h17-22H,1-12H3/b19-17+,20-18+ |
| InChIKey | YHMMTACPTYDQFO-XPWSMXQVSA-N |
| XLogP | 8.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.64 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|