C20H38 — CID 100951215
3,6-ditert-butyl-2,2,7,7-tetramethylocta-3,5-diene (PubChem CID 100951215) has the molecular formula C20H38 and a molecular weight of 278.52 g/mol. Its IUPAC name is 3,6-ditert-butyl-2,2,7,7-tetramethylocta-3,5-diene.
| Compound Name | 3,6-ditert-butyl-2,2,7,7-tetramethylocta-3,5-diene |
|---|---|
| PubChem CID | 100951215 |
| Molecular Formula | C20H38 |
| Molecular Weight | 278.52 g/mol |
| Exact Mass | 278.30 |
| IUPAC Name | 3,6-ditert-butyl-2,2,7,7-tetramethylocta-3,5-diene |
| SMILES | CC(C)(C)C(=CC=C(C(C)(C)C)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C20H38/c1-17(2,3)15(18(4,5)6)13-14-16(19(7,8)9)20(10,11)12/h13-14H,1-12H3 |
| InChIKey | XESOHRPETHMNOZ-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.52 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|