C26H44 — CID 91359683
3,12-ditert-butyl-2,2,13,13-tetramethyltetradeca-3,5,7,9,11-pentaene (PubChem CID 91359683) has the molecular formula C26H44 and a molecular weight of 356.64 g/mol. Its IUPAC name is 3,12-ditert-butyl-2,2,13,13-tetramethyltetradeca-3,5,7,9,11-pentaene.
| Compound Name | 3,12-ditert-butyl-2,2,13,13-tetramethyltetradeca-3,5,7,9,11-pentaene |
|---|---|
| PubChem CID | 91359683 |
| Molecular Formula | C26H44 |
| Molecular Weight | 356.64 g/mol |
| Exact Mass | 356.34 |
| IUPAC Name | 3,12-ditert-butyl-2,2,13,13-tetramethyltetradeca-3,5,7,9,11-pentaene |
| SMILES | CC(C)(C)C(=CC=CC=CC=CC=C(C(C)(C)C)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C26H44/c1-23(2,3)21(24(4,5)6)19-17-15-13-14-16-18-20-22(25(7,8)9)26(10,11)12/h13-20H,1-12H3 |
| InChIKey | UNXYRDOHAUDJHL-UHFFFAOYSA-N |
| XLogP | 8.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.64 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|