C24H42 — CID 91600432
3,10-ditert-butyl-2,2,11,11-tetramethyldodeca-3,5,7,9-tetraene (PubChem CID 91600432) has the molecular formula C24H42 and a molecular weight of 330.60 g/mol. Its IUPAC name is 3,10-ditert-butyl-2,2,11,11-tetramethyldodeca-3,5,7,9-tetraene.
| Compound Name | 3,10-ditert-butyl-2,2,11,11-tetramethyldodeca-3,5,7,9-tetraene |
|---|---|
| PubChem CID | 91600432 |
| Molecular Formula | C24H42 |
| Molecular Weight | 330.60 g/mol |
| Exact Mass | 330.33 |
| IUPAC Name | 3,10-ditert-butyl-2,2,11,11-tetramethyldodeca-3,5,7,9-tetraene |
| SMILES | CC(C)(C)C(=CC=CC=CC=C(C(C)(C)C)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C24H42/c1-21(2,3)19(22(4,5)6)17-15-13-14-16-18-20(23(7,8)9)24(10,11)12/h13-18H,1-12H3 |
| InChIKey | QIDFJTPXOBHYTH-UHFFFAOYSA-N |
| XLogP | 8.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.60 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|