C18H32 — CID 57352584
cyclopentene;penta-1,3-diene;2,4,4-trimethylpent-1-ene (PubChem CID 57352584) has the molecular formula C18H32 and a molecular weight of 248.45 g/mol. Its IUPAC name is cyclopentene;penta-1,3-diene;2,4,4-trimethylpent-1-ene.
| Compound Name | cyclopentene;penta-1,3-diene;2,4,4-trimethylpent-1-ene |
|---|---|
| PubChem CID | 57352584 |
| Molecular Formula | C18H32 |
| Molecular Weight | 248.45 g/mol |
| Exact Mass | 248.25 |
| IUPAC Name | cyclopentene;penta-1,3-diene;2,4,4-trimethylpent-1-ene |
| SMILES | C1=CCCC1.C=C(C)CC(C)(C)C.C=CC=CC |
| InChI | InChI=1S/C8H16.2C5H8/c1-7(2)6-8(3,4)5;1-2-4-5-3-1;1-3-5-4-2/h1,6H2,2-5H3;1-2H,3-5H2;3-5H,1H2,2H3 |
| InChIKey | HQRFEDPXVBLVRZ-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.45 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|