C24H40 — CID 10903585
(1E,3E,5E,7E)-1,3,5,7-tetratert-butylcycloocta-1,3,5,7-tetraene (PubChem CID 10903585) has the molecular formula C24H40 and a molecular weight of 328.58 g/mol. Its IUPAC name is (1E,3E,5E,7E)-1,3,5,7-tetratert-butylcycloocta-1,3,5,7-tetraene.
| Compound Name | (1E,3E,5E,7E)-1,3,5,7-tetratert-butylcycloocta-1,3,5,7-tetraene |
|---|---|
| PubChem CID | 10903585 |
| Molecular Formula | C24H40 |
| Molecular Weight | 328.58 g/mol |
| Exact Mass | 328.31 |
| IUPAC Name | (1E,3E,5E,7E)-1,3,5,7-tetratert-butylcycloocta-1,3,5,7-tetraene |
| SMILES | CC(C)(C)C1=C/C(C(C)(C)C)=C\C(C(C)(C)C)=C/C(C(C)(C)C)=C\1 |
| InChI | InChI=1S/C24H40/c1-21(2,3)17-13-18(22(4,5)6)15-20(24(10,11)12)16-19(14-17)23(7,8)9/h13-16H,1-12H3/b17-13+,17-14+,18-13+,18-15+,19-14+,19-16+,20-15+,20-16+ |
| InChIKey | MZOKJNWVASRQSV-VJKWWKQNSA-N |
| XLogP | 7.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.58 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |