C9H18N2O4P2 — CID 20677767
diphosphanyl 3-amino-4-[methyl(3-oxobutan-2-yl)amino]-4-oxobutanoate (PubChem CID 20677767) has the molecular formula C9H18N2O4P2 and a molecular weight of 280.20 g/mol. Its IUPAC name is diphosphanyl 3-amino-4-[methyl(3-oxobutan-2-yl)amino]-4-oxobutanoate.
| Compound Name | diphosphanyl 3-amino-4-[methyl(3-oxobutan-2-yl)amino]-4-oxobutanoate |
|---|---|
| PubChem CID | 20677767 |
| Molecular Formula | C9H18N2O4P2 |
| Molecular Weight | 280.20 g/mol |
| Exact Mass | 280.07 |
| IUPAC Name | diphosphanyl 3-amino-4-[methyl(3-oxobutan-2-yl)amino]-4-oxobutanoate |
| SMILES | CC(=O)C(C)N(C)C(=O)C(N)CC(=O)OPP |
| InChI | InChI=1S/C9H18N2O4P2/c1-5(6(2)12)11(3)9(14)7(10)4-8(13)15-17-16/h5,7,17H,4,10,16H2,1-3H3 |
| InChIKey | WATLNSPMNMZXBY-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.20 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|