C10H20N2O4P2 — CID 20736394
diphosphanyl 3-(methylamino)-4-[methyl(3-oxobutan-2-yl)amino]-4-oxobutanoate (PubChem CID 20736394) has the molecular formula C10H20N2O4P2 and a molecular weight of 294.23 g/mol. Its IUPAC name is diphosphanyl 3-(methylamino)-4-[methyl(3-oxobutan-2-yl)amino]-4-oxobutanoate.
| Compound Name | diphosphanyl 3-(methylamino)-4-[methyl(3-oxobutan-2-yl)amino]-4-oxobutanoate |
|---|---|
| PubChem CID | 20736394 |
| Molecular Formula | C10H20N2O4P2 |
| Molecular Weight | 294.23 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | diphosphanyl 3-(methylamino)-4-[methyl(3-oxobutan-2-yl)amino]-4-oxobutanoate |
| SMILES | CNC(CC(=O)OPP)C(=O)N(C)C(C)C(C)=O |
| InChI | InChI=1S/C10H20N2O4P2/c1-6(7(2)13)12(4)10(15)8(11-3)5-9(14)16-18-17/h6,8,11,18H,5,17H2,1-4H3 |
| InChIKey | WRYKAIKOYRFQPL-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.23 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|