C11H20BN3O3 — CID 20736384
CID 20736384 (PubChem CID 20736384) has the molecular formula C11H20BN3O3 and a molecular weight of 253.11 g/mol.
| Compound Name | CID 20736384 |
|---|---|
| PubChem CID | 20736384 |
| Molecular Formula | C11H20BN3O3 |
| Molecular Weight | 253.11 g/mol |
| Exact Mass | 253.16 |
| IUPAC Name | — |
| SMILES | [B]N(C)CC(=O)NC(C)C(=O)N(C)C(C)C(C)=O |
| InChI | InChI=1S/C11H20BN3O3/c1-7(13-10(17)6-14(4)12)11(18)15(5)8(2)9(3)16/h7-8H,6H2,1-5H3,(H,13,17) |
| InChIKey | ISLABSZZFHFOFR-UHFFFAOYSA-N |
| XLogP | -1.06 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.11 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|