C12H22N2O6Zn — CID 163678788
3-amino-4-oxopentanoic acid;methyl 3-(methylamino)-4-oxopentanoate;zinc (PubChem CID 163678788) has the molecular formula C12H22N2O6Zn and a molecular weight of 355.71 g/mol. Its IUPAC name is 3-amino-4-oxopentanoic acid;methyl 3-(methylamino)-4-oxopentanoate;zinc.
| Compound Name | 3-amino-4-oxopentanoic acid;methyl 3-(methylamino)-4-oxopentanoate;zinc |
|---|---|
| PubChem CID | 163678788 |
| Molecular Formula | C12H22N2O6Zn |
| Molecular Weight | 355.71 g/mol |
| Exact Mass | 354.08 |
| IUPAC Name | 3-amino-4-oxopentanoic acid;methyl 3-(methylamino)-4-oxopentanoate;zinc |
| SMILES | CC(=O)C(N)CC(=O)O.CNC(CC(=O)OC)C(C)=O.[Zn] |
| InChI | InChI=1S/C7H13NO3.C5H9NO3.Zn/c1-5(9)6(8-2)4-7(10)11-3;1-3(7)4(6)2-5(8)9;/h6,8H,4H2,1-3H3;4H,2,6H2,1H3,(H,8,9); |
| InChIKey | RXSARDDUGGNEJV-UHFFFAOYSA-N |
| XLogP | -0.90 |
| TPSA | 135.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.71 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|