C15H26Cl2N4O10S2 — CID 51353155
2-[[2-amino-3-[[2-amino-3-[(1-carboxy-3-methoxy-3-oxopropyl)amino]-3-oxopropyl]disulfanyl]propanoyl]amino]butanedioic acid;dihydrochloride (PubChem CID 51353155) has the molecular formula C15H26Cl2N4O10S2 and a molecular weight of 557.43 g/mol. Its IUPAC name is 2-[[2-amino-3-[[2-amino-3-[(1-carboxy-3-methoxy-3-oxopropyl)amino]-3-oxopropyl]disulfanyl]propanoyl]amino]butanedioic acid;dihydrochloride.
| Compound Name | 2-[[2-amino-3-[[2-amino-3-[(1-carboxy-3-methoxy-3-oxopropyl)amino]-3-oxopropyl]disulfanyl]propanoyl]amino]butanedioic acid;dihydrochloride |
|---|---|
| PubChem CID | 51353155 |
| Molecular Formula | C15H26Cl2N4O10S2 |
| Molecular Weight | 557.43 g/mol |
| Exact Mass | 556.05 |
| IUPAC Name | 2-[[2-amino-3-[[2-amino-3-[(1-carboxy-3-methoxy-3-oxopropyl)amino]-3-oxopropyl]disulfanyl]propanoyl]amino]butanedioic acid;dihydrochloride |
| SMILES | COC(=O)CC(NC(=O)C(N)CSSCC(N)C(=O)NC(CC(=O)O)C(=O)O)C(=O)O.Cl.Cl |
| InChI | InChI=1S/C15H24N4O10S2.2ClH/c1-29-11(22)3-9(15(27)28)19-13(24)7(17)5-31-30-4-6(16)12(23)18-8(14(25)26)2-10(20)21;;/h6-9H,2-5,16-17H2,1H3,(H,18,23)(H,19,24)(H,20,21)(H,25,26)(H,27,28);2*1H |
| InChIKey | NCZQDAKVWFOZDB-UHFFFAOYSA-N |
| XLogP | -1.96 |
| TPSA | 248.44 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.43 |
| LogP ≤ 5 | -1.96 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|