C10H18N2O5S — CID 104908451
(2S)-2-[[(2R)-2-amino-4-methylsulfanylbutanoyl]amino]-4-methoxy-4-oxobutanoic acid (PubChem CID 104908451) has the molecular formula C10H18N2O5S and a molecular weight of 278.33 g/mol. Its IUPAC name is (2S)-2-[[(2R)-2-amino-4-methylsulfanylbutanoyl]amino]-4-methoxy-4-oxobutanoic acid.
| Compound Name | (2S)-2-[[(2R)-2-amino-4-methylsulfanylbutanoyl]amino]-4-methoxy-4-oxobutanoic acid |
|---|---|
| PubChem CID | 104908451 |
| Molecular Formula | C10H18N2O5S |
| Molecular Weight | 278.33 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | (2S)-2-[[(2R)-2-amino-4-methylsulfanylbutanoyl]amino]-4-methoxy-4-oxobutanoic acid |
| SMILES | COC(=O)C[C@H](NC(=O)[C@H](N)CCSC)C(=O)O |
| InChI | InChI=1S/C10H18N2O5S/c1-17-8(13)5-7(10(15)16)12-9(14)6(11)3-4-18-2/h6-7H,3-5,11H2,1-2H3,(H,12,14)(H,15,16)/t6-,7+/m1/s1 |
| InChIKey | HWMABKUFFOFQQU-RQJHMYQMSA-N |
| XLogP | -0.80 |
| TPSA | 118.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.33 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |