C14H20O3S — CID 20677811
2-(hydroxymethyl)-3,5-dimethyl-6-phenylsulfanyloxan-4-ol (PubChem CID 20677811) has the molecular formula C14H20O3S and a molecular weight of 268.38 g/mol. Its IUPAC name is 2-(hydroxymethyl)-3,5-dimethyl-6-phenylsulfanyloxan-4-ol.
| Compound Name | 2-(hydroxymethyl)-3,5-dimethyl-6-phenylsulfanyloxan-4-ol |
|---|---|
| PubChem CID | 20677811 |
| Molecular Formula | C14H20O3S |
| Molecular Weight | 268.38 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | 2-(hydroxymethyl)-3,5-dimethyl-6-phenylsulfanyloxan-4-ol |
| SMILES | CC1C(CO)OC(Sc2ccccc2)C(C)C1O |
| InChI | InChI=1S/C14H20O3S/c1-9-12(8-15)17-14(10(2)13(9)16)18-11-6-4-3-5-7-11/h3-7,9-10,12-16H,8H2,1-2H3 |
| InChIKey | ZXYHAHFKLFBJFB-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.38 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |