C16H16N4OS — CID 20677967
4-N-[(E)-(6-methoxy-3-methyl-1,3-benzothiazol-2-ylidene)amino]-1-N-methylcyclohexa-2,5-diene-1,4-diimine (PubChem CID 20677967) has the molecular formula C16H16N4OS and a molecular weight of 312.40 g/mol. Its IUPAC name is 4-N-[(E)-(6-methoxy-3-methyl-1,3-benzothiazol-2-ylidene)amino]-1-N-methylcyclohexa-2,5-diene-1,4-diimine.
| Compound Name | 4-N-[(E)-(6-methoxy-3-methyl-1,3-benzothiazol-2-ylidene)amino]-1-N-methylcyclohexa-2,5-diene-1,4-diimine |
|---|---|
| PubChem CID | 20677967 |
| Molecular Formula | C16H16N4OS |
| Molecular Weight | 312.40 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | 4-N-[(E)-(6-methoxy-3-methyl-1,3-benzothiazol-2-ylidene)amino]-1-N-methylcyclohexa-2,5-diene-1,4-diimine |
| SMILES | CN=C1C=CC(=N/N=c2/sc3cc(OC)ccc3n2C)C=C1 |
| InChI | InChI=1S/C16H16N4OS/c1-17-11-4-6-12(7-5-11)18-19-16-20(2)14-9-8-13(21-3)10-15(14)22-16/h4-10H,1-3H3/b17-11-,18-12+,19-16+ |
| InChIKey | KBPCVHZNUZRGGA-DDWOLHQKSA-N |
| XLogP | 2.70 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.40 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|