C23H32N2 — CID 20681050
2-[2,3-dimethyl-4-(3,3,4,5-tetramethylpyrrol-2-yl)cyclopenta-1,3-dien-1-yl]-3,3,4,5-tetramethylpyrrole (PubChem CID 20681050) has the molecular formula C23H32N2 and a molecular weight of 336.52 g/mol. Its IUPAC name is 2-[2,3-dimethyl-4-(3,3,4,5-tetramethylpyrrol-2-yl)cyclopenta-1,3-dien-1-yl]-3,3,4,5-tetramethylpyrrole.
| Compound Name | 2-[2,3-dimethyl-4-(3,3,4,5-tetramethylpyrrol-2-yl)cyclopenta-1,3-dien-1-yl]-3,3,4,5-tetramethylpyrrole |
|---|---|
| PubChem CID | 20681050 |
| Molecular Formula | C23H32N2 |
| Molecular Weight | 336.52 g/mol |
| Exact Mass | 336.26 |
| IUPAC Name | 2-[2,3-dimethyl-4-(3,3,4,5-tetramethylpyrrol-2-yl)cyclopenta-1,3-dien-1-yl]-3,3,4,5-tetramethylpyrrole |
| SMILES | CC1=C(C)C(C)(C)C(C2=C(C)C(C)=C(C3=NC(C)=C(C)C3(C)C)C2)=N1 |
| InChI | InChI=1S/C23H32N2/c1-12-13(2)19(21-23(9,10)15(4)17(6)25-21)11-18(12)20-22(7,8)14(3)16(5)24-20/h11H2,1-10H3 |
| InChIKey | FXCAGXNONLGGQY-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.52 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |