C20H36N2 — CID 14644664
N,2,4,5-tetratert-butylpyrrol-3-imine (PubChem CID 14644664) has the molecular formula C20H36N2 and a molecular weight of 304.52 g/mol. Its IUPAC name is N,2,4,5-tetratert-butylpyrrol-3-imine.
| Compound Name | N,2,4,5-tetratert-butylpyrrol-3-imine |
|---|---|
| PubChem CID | 14644664 |
| Molecular Formula | C20H36N2 |
| Molecular Weight | 304.52 g/mol |
| Exact Mass | 304.29 |
| IUPAC Name | N,2,4,5-tetratert-butylpyrrol-3-imine |
| SMILES | CC(C)(C)/N=C1\C(C(C)(C)C)=NC(C(C)(C)C)=C1C(C)(C)C |
| InChI | InChI=1S/C20H36N2/c1-17(2,3)13-14(22-20(10,11)12)16(19(7,8)9)21-15(13)18(4,5)6/h1-12H3/b22-14- |
| InChIKey | LUMDRROFCFSNPB-HMAPJEAMSA-N |
| XLogP | 6.07 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.52 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|