C17H30N2 — CID 14644662
2,4,5-tritert-butyl-N-methylpyrrol-3-imine (PubChem CID 14644662) has the molecular formula C17H30N2 and a molecular weight of 262.44 g/mol. Its IUPAC name is 2,4,5-tritert-butyl-N-methylpyrrol-3-imine.
| Compound Name | 2,4,5-tritert-butyl-N-methylpyrrol-3-imine |
|---|---|
| PubChem CID | 14644662 |
| Molecular Formula | C17H30N2 |
| Molecular Weight | 262.44 g/mol |
| Exact Mass | 262.24 |
| IUPAC Name | 2,4,5-tritert-butyl-N-methylpyrrol-3-imine |
| SMILES | C/N=C1\C(C(C)(C)C)=NC(C(C)(C)C)=C1C(C)(C)C |
| InChI | InChI=1S/C17H30N2/c1-15(2,3)11-12(18-10)14(17(7,8)9)19-13(11)16(4,5)6/h1-10H3/b18-12- |
| InChIKey | TVXHUBYGIFBVHM-PDGQHHTCSA-N |
| XLogP | 4.90 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.44 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|