C25H20F6N2O4 — CID 20681988
4-acetyl-N-[5-[1,1,1,3,3,3-hexafluoro-2-[4-hydroxy-3-(methylamino)phenyl]propan-2-yl]-2-hydroxyphenyl]benzamide (PubChem CID 20681988) has the molecular formula C25H20F6N2O4 and a molecular weight of 526.43 g/mol. Its IUPAC name is 4-acetyl-N-[5-[1,1,1,3,3,3-hexafluoro-2-[4-hydroxy-3-(methylamino)phenyl]propan-2-yl]-2-hydroxyphenyl]benzamide.
| Compound Name | 4-acetyl-N-[5-[1,1,1,3,3,3-hexafluoro-2-[4-hydroxy-3-(methylamino)phenyl]propan-2-yl]-2-hydroxyphenyl]benzamide |
|---|---|
| PubChem CID | 20681988 |
| Molecular Formula | C25H20F6N2O4 |
| Molecular Weight | 526.43 g/mol |
| Exact Mass | 526.13 |
| IUPAC Name | 4-acetyl-N-[5-[1,1,1,3,3,3-hexafluoro-2-[4-hydroxy-3-(methylamino)phenyl]propan-2-yl]-2-hydroxyphenyl]benzamide |
| SMILES | CNc1cc(C(c2ccc(O)c(NC(=O)c3ccc(C(C)=O)cc3)c2)(C(F)(F)F)C(F)(F)F)ccc1O |
| InChI | InChI=1S/C25H20F6N2O4/c1-13(34)14-3-5-15(6-4-14)22(37)33-19-12-17(8-10-21(19)36)23(24(26,27)28,25(29,30)31)16-7-9-20(35)18(11-16)32-2/h3-12,32,35-36H,1-2H3,(H,33,37) |
| InChIKey | ZGWGUABVVZQRSP-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.43 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|