C21H27NO6S — CID 20682030
4-[2-(4-butoxyphenyl)sulfinamoyloxy-5-methylphenoxy]butanoic acid (PubChem CID 20682030) has the molecular formula C21H27NO6S and a molecular weight of 421.52 g/mol. Its IUPAC name is 4-[2-(4-butoxyphenyl)sulfinamoyloxy-5-methylphenoxy]butanoic acid.
| Compound Name | 4-[2-(4-butoxyphenyl)sulfinamoyloxy-5-methylphenoxy]butanoic acid |
|---|---|
| PubChem CID | 20682030 |
| Molecular Formula | C21H27NO6S |
| Molecular Weight | 421.52 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | 4-[2-(4-butoxyphenyl)sulfinamoyloxy-5-methylphenoxy]butanoic acid |
| SMILES | CCCCOc1ccc(NS(=O)Oc2ccc(C)cc2OCCCC(=O)O)cc1 |
| InChI | InChI=1S/C21H27NO6S/c1-3-4-13-26-18-10-8-17(9-11-18)22-29(25)28-19-12-7-16(2)15-20(19)27-14-5-6-21(23)24/h7-12,15,22H,3-6,13-14H2,1-2H3,(H,23,24) |
| InChIKey | ABFZYZVOVZMJPA-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.52 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|