C14H12N4 — CID 20684000
2-(5-methyl-2-phenyl-1H-imidazol-4-yl)pyrazine (PubChem CID 20684000) has the molecular formula C14H12N4 and a molecular weight of 236.28 g/mol. Its IUPAC name is 2-(5-methyl-2-phenyl-1H-imidazol-4-yl)pyrazine.
| Compound Name | 2-(5-methyl-2-phenyl-1H-imidazol-4-yl)pyrazine |
|---|---|
| PubChem CID | 20684000 |
| Molecular Formula | C14H12N4 |
| Molecular Weight | 236.28 g/mol |
| Exact Mass | 236.11 |
| IUPAC Name | 2-(5-methyl-2-phenyl-1H-imidazol-4-yl)pyrazine |
| SMILES | Cc1[nH]c(-c2ccccc2)nc1-c1cnccn1 |
| InChI | InChI=1S/C14H12N4/c1-10-13(12-9-15-7-8-16-12)18-14(17-10)11-5-3-2-4-6-11/h2-9H,1H3,(H,17,18) |
| InChIKey | ABPVXLKKBDVAOW-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.28 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |