C38H27F6NO4 — CID 20685052
2-[4-[4-[1,1,1,3,3,3-hexafluoro-2-[4-(4-propan-2-ylphenoxy)phenyl]propan-2-yl]phenoxy]phenyl]isoindole-1,3-dione (PubChem CID 20685052) has the molecular formula C38H27F6NO4 and a molecular weight of 675.63 g/mol. Its IUPAC name is 2-[4-[4-[1,1,1,3,3,3-hexafluoro-2-[4-(4-propan-2-ylphenoxy)phenyl]propan-2-yl]phenoxy]phenyl]isoindole-1,3-dione.
| Compound Name | 2-[4-[4-[1,1,1,3,3,3-hexafluoro-2-[4-(4-propan-2-ylphenoxy)phenyl]propan-2-yl]phenoxy]phenyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 20685052 |
| Molecular Formula | C38H27F6NO4 |
| Molecular Weight | 675.63 g/mol |
| Exact Mass | 675.18 |
| IUPAC Name | 2-[4-[4-[1,1,1,3,3,3-hexafluoro-2-[4-(4-propan-2-ylphenoxy)phenyl]propan-2-yl]phenoxy]phenyl]isoindole-1,3-dione |
| SMILES | CC(C)c1ccc(Oc2ccc(C(c3ccc(Oc4ccc(N5C(=O)c6ccccc6C5=O)cc4)cc3)(C(F)(F)F)C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C38H27F6NO4/c1-23(2)24-7-15-28(16-8-24)48-29-17-9-25(10-18-29)36(37(39,40)41,38(42,43)44)26-11-19-30(20-12-26)49-31-21-13-27(14-22-31)45-34(46)32-5-3-4-6-33(32)35(45)47/h3-23H,1-2H3 |
| InChIKey | UDFFWMZKLAMQHV-UHFFFAOYSA-N |
| XLogP | 10.61 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.63 |
| LogP ≤ 5 | 10.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|