C26H20F3NO5 — CID 169217144
(1R,2R,6S,7S,8S,10R)-4-[4-[2-oxo-2-[4-(trifluoromethoxy)phenyl]ethoxy]phenyl]-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione (PubChem CID 169217144) has the molecular formula C26H20F3NO5 and a molecular weight of 483.44 g/mol. Its IUPAC name is (1R,2R,6S,7S,8S,10R)-4-[4-[2-oxo-2-[4-(trifluoromethoxy)phenyl]ethoxy]phenyl]-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione.
| Compound Name | (1R,2R,6S,7S,8S,10R)-4-[4-[2-oxo-2-[4-(trifluoromethoxy)phenyl]ethoxy]phenyl]-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione |
|---|---|
| PubChem CID | 169217144 |
| Molecular Formula | C26H20F3NO5 |
| Molecular Weight | 483.44 g/mol |
| Exact Mass | 483.13 |
| IUPAC Name | (1R,2R,6S,7S,8S,10R)-4-[4-[2-oxo-2-[4-(trifluoromethoxy)phenyl]ethoxy]phenyl]-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione |
| SMILES | O=C(COc1ccc(N2C(=O)[C@@H]3[C@@H]4C=C[C@@H]([C@H]5C[C@@H]45)[C@@H]3C2=O)cc1)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C26H20F3NO5/c27-26(28,29)35-16-5-1-13(2-6-16)21(31)12-34-15-7-3-14(4-8-15)30-24(32)22-17-9-10-18(20-11-19(17)20)23(22)25(30)33/h1-10,17-20,22-23H,11-12H2/t17-,18+,19+,20-,22-,23+ |
| InChIKey | ARDVGRYFFOJPAF-PATJUEJUSA-N |
| XLogP | 4.40 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.44 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|