C23H28O2 — CID 20685087
5,5'-di(propan-2-yloxy)-2,2'-spirobi[1,3-dihydroindene] (PubChem CID 20685087) has the molecular formula C23H28O2 and a molecular weight of 336.48 g/mol. Its IUPAC name is 5,5'-di(propan-2-yloxy)-2,2'-spirobi[1,3-dihydroindene].
| Compound Name | 5,5'-di(propan-2-yloxy)-2,2'-spirobi[1,3-dihydroindene] |
|---|---|
| PubChem CID | 20685087 |
| Molecular Formula | C23H28O2 |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.21 |
| IUPAC Name | 5,5'-di(propan-2-yloxy)-2,2'-spirobi[1,3-dihydroindene] |
| SMILES | CC(C)Oc1ccc2c(c1)CC1(C2)Cc2ccc(OC(C)C)cc2C1 |
| InChI | InChI=1S/C23H28O2/c1-15(2)24-21-7-5-17-11-23(13-19(17)9-21)12-18-6-8-22(25-16(3)4)10-20(18)14-23/h5-10,15-16H,11-14H2,1-4H3 |
| InChIKey | RLWUGGSHIFCIDO-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |