C12H15NO — CID 89252566
2-methylidene-5-propan-2-yloxy-1,3-dihydroindole (PubChem CID 89252566) has the molecular formula C12H15NO and a molecular weight of 189.26 g/mol. Its IUPAC name is 2-methylidene-5-propan-2-yloxy-1,3-dihydroindole.
| Compound Name | 2-methylidene-5-propan-2-yloxy-1,3-dihydroindole |
|---|---|
| PubChem CID | 89252566 |
| Molecular Formula | C12H15NO |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.12 |
| IUPAC Name | 2-methylidene-5-propan-2-yloxy-1,3-dihydroindole |
| SMILES | C=C1Cc2cc(OC(C)C)ccc2N1 |
| InChI | InChI=1S/C12H15NO/c1-8(2)14-11-4-5-12-10(7-11)6-9(3)13-12/h4-5,7-8,13H,3,6H2,1-2H3 |
| InChIKey | JPKXCYCOFYDMNK-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |