C15H23NO — CID 71367324
2,2,4-trimethyl-7-propan-2-yloxy-3,4-dihydro-1H-quinoline (PubChem CID 71367324) has the molecular formula C15H23NO and a molecular weight of 233.35 g/mol. Its IUPAC name is 2,2,4-trimethyl-7-propan-2-yloxy-3,4-dihydro-1H-quinoline.
| Compound Name | 2,2,4-trimethyl-7-propan-2-yloxy-3,4-dihydro-1H-quinoline |
|---|---|
| PubChem CID | 71367324 |
| Molecular Formula | C15H23NO |
| Molecular Weight | 233.35 g/mol |
| Exact Mass | 233.18 |
| IUPAC Name | 2,2,4-trimethyl-7-propan-2-yloxy-3,4-dihydro-1H-quinoline |
| SMILES | CC(C)Oc1ccc2c(c1)NC(C)(C)CC2C |
| InChI | InChI=1S/C15H23NO/c1-10(2)17-12-6-7-13-11(3)9-15(4,5)16-14(13)8-12/h6-8,10-11,16H,9H2,1-5H3 |
| InChIKey | KNTVHFUMKKUIJF-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.35 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |