C13H14O5 — CID 20686270
11-oxatetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4,5-dicarboxylic acid (PubChem CID 20686270) has the molecular formula C13H14O5 and a molecular weight of 250.25 g/mol. Its IUPAC name is 11-oxatetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4,5-dicarboxylic acid.
| Compound Name | 11-oxatetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4,5-dicarboxylic acid |
|---|---|
| PubChem CID | 20686270 |
| Molecular Formula | C13H14O5 |
| Molecular Weight | 250.25 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | 11-oxatetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4,5-dicarboxylic acid |
| SMILES | O=C(O)C1C2CC(C1C(=O)O)C1C3C=CC(O3)C21 |
| InChI | InChI=1S/C13H14O5/c14-12(15)10-4-3-5(11(10)13(16)17)9-7-2-1-6(18-7)8(4)9/h1-2,4-11H,3H2,(H,14,15)(H,16,17) |
| InChIKey | SDVFCMSIUWKULK-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.25 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|