C12H10O5 — CID 20686293
11,14,15-trioxapentacyclo[6.5.1.13,6.02,7.09,13]pentadec-4-ene-10,12-dione (PubChem CID 20686293) has the molecular formula C12H10O5 and a molecular weight of 234.21 g/mol. Its IUPAC name is 11,14,15-trioxapentacyclo[6.5.1.13,6.02,7.09,13]pentadec-4-ene-10,12-dione.
| Compound Name | 11,14,15-trioxapentacyclo[6.5.1.13,6.02,7.09,13]pentadec-4-ene-10,12-dione |
|---|---|
| PubChem CID | 20686293 |
| Molecular Formula | C12H10O5 |
| Molecular Weight | 234.21 g/mol |
| Exact Mass | 234.05 |
| IUPAC Name | 11,14,15-trioxapentacyclo[6.5.1.13,6.02,7.09,13]pentadec-4-ene-10,12-dione |
| SMILES | O=C1OC(=O)C2C3OC(C12)C1C2C=CC(O2)C31 |
| InChI | InChI=1S/C12H10O5/c13-11-7-8(12(14)17-11)10-6-4-2-1-3(15-4)5(6)9(7)16-10/h1-10H |
| InChIKey | GFIMUFHQPCGCST-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.21 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|