C18H26N4O2 — CID 20686996
4-[8-(4-hydroxybutyl)-1-oxa-2,8-diazaspiro[4.5]dec-2-en-3-yl]benzenecarboximidamide (PubChem CID 20686996) has the molecular formula C18H26N4O2 and a molecular weight of 330.43 g/mol. Its IUPAC name is 4-[8-(4-hydroxybutyl)-1-oxa-2,8-diazaspiro[4.5]dec-2-en-3-yl]benzenecarboximidamide.
| Compound Name | 4-[8-(4-hydroxybutyl)-1-oxa-2,8-diazaspiro[4.5]dec-2-en-3-yl]benzenecarboximidamide |
|---|---|
| PubChem CID | 20686996 |
| Molecular Formula | C18H26N4O2 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.21 |
| IUPAC Name | 4-[8-(4-hydroxybutyl)-1-oxa-2,8-diazaspiro[4.5]dec-2-en-3-yl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(C2=NOC3(CCN(CCCCO)CC3)C2)cc1 |
| InChI | InChI=1S/C18H26N4O2/c19-17(20)15-5-3-14(4-6-15)16-13-18(24-21-16)7-10-22(11-8-18)9-1-2-12-23/h3-6,23H,1-2,7-13H2,(H3,19,20) |
| InChIKey | ZMVQTIMQEPYSPL-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 94.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|