C29H30N2O4S — CID 20687033
[22-(cyclopropylmethyl)-2-hydroxy-8-methylsulfanyl-14-oxa-11,22-diazaheptacyclo[13.9.1.01,13.02,21.04,12.05,10.019,25]pentacosa-4(12),5(10),6,8,15,17,19(25)-heptaen-16-yl] acetate (PubChem CID 20687033) has the molecular formula C29H30N2O4S and a molecular weight of 502.64 g/mol. Its IUPAC name is [22-(cyclopropylmethyl)-2-hydroxy-8-methylsulfanyl-14-oxa-11,22-diazaheptacyclo[13.9.1.01,13.02,21.04,12.05,10.019,25]pentacosa-4(12),5(10),6,8,15,17,19(25)-heptaen-16-yl] acetate.
| Compound Name | [22-(cyclopropylmethyl)-2-hydroxy-8-methylsulfanyl-14-oxa-11,22-diazaheptacyclo[13.9.1.01,13.02,21.04,12.05,10.019,25]pentacosa-4(12),5(10),6,8,15,17,19(25)-heptaen-16-yl] acetate |
|---|---|
| PubChem CID | 20687033 |
| Molecular Formula | C29H30N2O4S |
| Molecular Weight | 502.64 g/mol |
| Exact Mass | 502.19 |
| IUPAC Name | [22-(cyclopropylmethyl)-2-hydroxy-8-methylsulfanyl-14-oxa-11,22-diazaheptacyclo[13.9.1.01,13.02,21.04,12.05,10.019,25]pentacosa-4(12),5(10),6,8,15,17,19(25)-heptaen-16-yl] acetate |
| SMILES | CSc1ccc2c3c([nH]c2c1)C1Oc2c(OC(C)=O)ccc4c2C12CCN(CC1CC1)C(C4)C2(O)C3 |
| InChI | InChI=1S/C29H30N2O4S/c1-15(32)34-22-8-5-17-11-23-29(33)13-20-19-7-6-18(36-2)12-21(19)30-25(20)27-28(29,24(17)26(22)35-27)9-10-31(23)14-16-3-4-16/h5-8,12,16,23,27,30,33H,3-4,9-11,13-14H2,1-2H3 |
| InChIKey | WDSMGKCAYDXBOZ-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 74.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.64 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|