C31H32N2O5S — CID 20687034
[2-acetyloxy-22-(cyclopropylmethyl)-8-methylsulfanyl-14-oxa-11,22-diazaheptacyclo[13.9.1.01,13.02,21.04,12.05,10.019,25]pentacosa-4(12),5(10),6,8,15,17,19(25)-heptaen-16-yl] acetate (PubChem CID 20687034) has the molecular formula C31H32N2O5S and a molecular weight of 544.67 g/mol. Its IUPAC name is [2-acetyloxy-22-(cyclopropylmethyl)-8-methylsulfanyl-14-oxa-11,22-diazaheptacyclo[13.9.1.01,13.02,21.04,12.05,10.019,25]pentacosa-4(12),5(10),6,8,15,17,19(25)-heptaen-16-yl] acetate.
| Compound Name | [2-acetyloxy-22-(cyclopropylmethyl)-8-methylsulfanyl-14-oxa-11,22-diazaheptacyclo[13.9.1.01,13.02,21.04,12.05,10.019,25]pentacosa-4(12),5(10),6,8,15,17,19(25)-heptaen-16-yl] acetate |
|---|---|
| PubChem CID | 20687034 |
| Molecular Formula | C31H32N2O5S |
| Molecular Weight | 544.67 g/mol |
| Exact Mass | 544.20 |
| IUPAC Name | [2-acetyloxy-22-(cyclopropylmethyl)-8-methylsulfanyl-14-oxa-11,22-diazaheptacyclo[13.9.1.01,13.02,21.04,12.05,10.019,25]pentacosa-4(12),5(10),6,8,15,17,19(25)-heptaen-16-yl] acetate |
| SMILES | CSc1ccc2c3c([nH]c2c1)C1Oc2c(OC(C)=O)ccc4c2C12CCN(CC1CC1)C(C4)C2(OC(C)=O)C3 |
| InChI | InChI=1S/C31H32N2O5S/c1-16(34)36-24-9-6-19-12-25-31(38-17(2)35)14-22-21-8-7-20(39-3)13-23(21)32-27(22)29-30(31,26(19)28(24)37-29)10-11-33(25)15-18-4-5-18/h6-9,13,18,25,29,32H,4-5,10-12,14-15H2,1-3H3 |
| InChIKey | PNJSJINFAXMVQX-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 80.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.67 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|